Glucuronolacton


C6H8O6







Drehung


Stereo

 
Zurück zur Liste
 


HUWagner
LMU München
17.11.2012
 


     SMILES: O[C@@H](C=O)[C@H]1OC(=O)[C@@H](O)[C@H]1O

     Geometrie: Molekülmechanik Kraftfeld Dreiding

     Rechte Maustaste = Jmol Menu
     Mittlere Maustaste = Molekül zoomen
     Linke Maustaste = Molekül bewegen