Mutarotation

Anomere
alpha-D-Gluco-pyranose
 
beta-D-Gluco-pyranose
   
 
 

D-Glucose
 
 
HUWagner + JBek
LMU München
11.5.2013
 
Zurück zur Liste
 
Geometrie:
Molekülmechanik
Dreiding Kraftfeld
 
Drehung   Stereo
   
Bindungen   Atome
   
 
Drehung   Stereo
   
Bindungen   Atome
   
   

       SMILES: OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O.OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O

       Linke Maustaste = Molekül bewegen
       Mittlere Maustaste = Molekül zoomen
       Rechte Maustaste = Jmol Menu