Gephyromantolid A

(3S,7E,11R)-3,7,11-Trimethyl-
1-oxacyclododec-7-en-2-one


C14H24O2

Drehung:
Stereo:
Bindungen:
Atome:

Julia Bek

HUWagner
LMU München
24.03.2012

Zurück zur Liste
SMILES: C[C@@H]1CC\C=C(C)\CCC[C@H](C)C(=O)OC1
Geometrie: Quantenchemisch DFT-B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen