alpha-D-Galacto-pyranose

beta-D-Galacto-pyranose

C6H12O6


D-Galactose

Anomere



HUWagner + JBek
LMU München
21.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O.OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen