Fmoc Fluorenyl-methoxy-carbonylchlorid

C15H11ClO2


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
03.06.2013


Zurück zur Liste
 
SMILES: ClC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C21
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen