Ferrocenyl-
dimethylallyl-
kation 82

C13H18FeN

Ladungen nicht angezeigt

Drehung
Stereo
Bindungen
Atome

Jörg Buchweitz

HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: [Fe].c1cccc1.C[n+](C):c:c:c:c1cccc1
Geometrie: Quantenchemisch DFT RB3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen