endo-Formyl-norbornen

exo-Formyl-norbornen

C8H10O


Formyl-norbornen
Bicyclo[2.2.1]hept-5-en-
2-carbaldehyde

2 Isomere







HUWagner + JBek
LMU München
17.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: O=C[C@H]1C[C@@H]2C[C@H]1C=C2.O=C[C@@H]1C[C@@H]2C[C@H]1C=C2
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen