Acetessigester
Ketoform

instabiler

Acetessigester
Enolform

stabiler

C6H10O3



Ethyl-3-oxobutanoat

Ethyl-(2Z)-3-hydroxy-
but-2-enoat



HUWagner + JBek
LMU München
21.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CCOC(=O)CC(C)=O.CCOC(=O)\C=C(\C)O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen