Östradiol

C18H24O2



Drehung:
Stereo:
Bindungen:
Atome:

L.Knüppel

HUWagner u JBek
LMU München
20.07.2013

Zurück zur Liste
SMILES: C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@H]2O
Geometrie: Molekül Mechanik Dreiding Kraftfeld
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen