Benzyl-phenyl-(trimethylsilyloxy)-
sulfoxonium-ylid

C16H22O2S Si


Drehung:
Stereo:
Bindungen:
Atome:

Gerhard Heywang

HUWagner + JBek
LMU München
03.10.2013

Zurück zur Liste
SMILES: C[Si](C)(C)O[S@@++]([O-])([CH-]C1=CC=CC=C1)C1=CCC=CC1
Geometrie: Molekül Mechanik Dreiding Kraftfeld
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen