Dichlordiphenyl-
trichlorethan
DDT

C14H19Cl5

Drehung:
Stereo:
Bindungen:
Atome:

Manfred Heuschmann

HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: Clc1ccc(cc1)C(c1ccc(Cl)cc1)C(Cl)(Cl)Cl
Geometrie: Molekül Mechanik Dreiding Kraftfeld
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen