Dichlorbicycloheptan

C7H10Cl2

Drehung
Stereo
Bindungen
Atome
Sebastian Vogel

HUWagner + JBek
LMU München
11.05.2013


Zurück zur Liste
 
SMILES: ClC1(Cl)[C@H]2CCCC[C@@H]12
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen