(3S)-3,4-Dibrom-but-1-en

(3R)-3,4-Dibrom-but-1-en

(2E)-1,4-Dibrom-but-2-en

C4H6Br2


Dibrombuten
Isomere






HUWagner + JBek
LMU München
17.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: BrC[C@@H](Br)C=C.BrC[C@H](Br)C=C.BrC\C=C\CBr
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen