Dibenzyliden-aceton

(1E,4E)-1,5-Diphenylpenta-
1,4-dien-3-on

C17H14O


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
22.06.2013


Zurück zur Liste
 
SMILES: O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen