Bis-(dimethylamino)-
cyclopropenylium-
pentacarbonyl-Mn-Komplex

C12H12MnN2O5

Ladungen nicht angezeigt

Drehung
Stereo
Bindungen
Atome

Ekkehard Bartmann

HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: C[N+](C)=c1[c-]c1=[N+](C)C.[O]#C[Mn](C#[O])(C#[O])(C#[O])C#[O]
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen