Cyclopentadien-Dimere   endo-Cycloaddition

 

(1S,2R,6S,7R)-

(1R,2S,6R,7S)-

C10H12

Tricyclo-[5.2.1.0 2.6]-
deca-3,8-diene






HUWagner + JBek
LMU München
14.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Drehung   Stereo
   
 

Cyclopentadien-Dimere   exo-Cycloaddition

 

(1S,2S,6R,7R)-

(1R,2R,6S,7S)-

C10H12

Tricyclo-[5.2.1.0 2.6]-
deca-3,8-diene






HUWagner + JBek
LMU München
07.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Drehung   Stereo
   
 

SMILES: C1C=C[C@@H]2[C@H]3C[C@H](C=C3)[C@H]12.C1C=C[C@H]2[C@@H]3C[C@@H](C=C3)[C@@H]12
SMILES: C1C=C[C@H]2[C@H]3C[C@H](C=C3)[C@@H]12.C1C=C[C@@H]2[C@@H]3C[C@@H](C=C3)[C@H]12
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen