Cyclamat

C6H12NO3S

Drehung
Stereo
Bindungen
Atome

HUWagner + JBek
LMU München
22.06.2013


Zurück zur Liste
SMILES: [O-][S++]([O-])([O-])NC1CCCCC1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen