Diazomethan-Angelat-Cycloaddukt

Diazomethan-Tiglat-Cycloaddukt

C7H12N2O2


Diazomethan-
Angelat/Tiglat-
Cycloaddukte



R. Huisgen

HUWagner + JBek
LMU München
13.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: COC(=O)[C@]1(C)N=NC[C@@H]1C.COC(=O)[C@@]1(C)N=NC[C@@H]1C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen