cis-Dekalin

trans-Dekalin

C10H18

cis/trans-Dekalin


Julia Bek

HUWagner
LMU München
17.11.2010

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C1CC[C@H]2CCCC[C@H]2C1.C1CC[C@H]2CCCC[C@@H]2C1
Geometrie: Molekül Mechanik Dreiding Kraftfeld
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen