Endo-Cyclopentadien-Maleinsäureanhydrid-
Diels-Alder-Addukt

Exo-Cyclopentadien-Maleinsäureanhydrid-
Diels-Alder-Addukt

C9H8O3


Endo/Exo-Cyclopentadien-Maleinsäureanhydrid-
Diels-Alder-Addukte






HUWagner + JBek
LMU München
03.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: [H][C@]12C[C@]([H])(C=C1)[C@H]1[C@@H]2C(=O)OC1=O.[H][C@]12C[C@]([H])(C=C1)[C@@H]1[C@H]2C(=O)OC1=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen