Zitronensäure
pH7: Trianion Citrat

C6H5O7

Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
22.06.2013


Zurück zur Liste
 
SMILES: C(=O)CC(CC(O)=O)C(O)=O.OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p) water
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen