cis-1.3-Dimethyl-cyclobutan

trans-1.3-Dimethylcyclobutan

   
an/aus


an/aus


 



 
Zurück zur Liste
 

HUWagner
LMU München
02.12.2010
 


     SMILES: C[C@H]1C[C@@H](C)C1.C[C@H]1C[C@H](C)C1

     Geometrie: Molekülmechanik Kraftfeld Dreiding

     Rechte Maustaste = Jmol Menu
     Mittlere Maustaste = Molekül zoomen
     Linke Maustaste = Molekül bewegen