Methyl equatorial - Chlor axial

Methyl axial - Chlor equatorial
weniger stabil



2 Konformere

HUWagner + JBek
LMU München

Zurück zur Liste
Drehung   Stereo
Bindungen   Atome
Drehung   Stereo
Bindungen   Atome

SMILES: C[C@H]1CC[C@@H](Cl)CC1.C[C@H]1CC[C@@H](Cl)CC1
Geometrie: Quantenchemisch MP2/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen