Chinolingelb

C18H11NO2


Drehung:
Stereo:
Bindungen:
Atome:

 

HUWagner + JBek
LMU München
11.2.2014

Zurück zur Liste
SMILES: O=C1C2=CC=CC=C2C(=O)C1=C1NC2=C(C=CC=C2)C=C1
Geometrie: Quantenchemisch DFT PBE Def2-SVP Def2-SVP/J
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen