7.7-(S.S'-Vinylendimercapto)-
8.8-dicyan-p-benzochinodimethan

C12H6N2S2

Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
SMILES: N#CC(C#N)=C1C=CC(C=C1)=C1SC=CS1
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen