alpha-Caryophyllen

C15H24

Drehung
Stereo
Bindungen
Atome
Thomas Rösener

HUWagner + JBek
LMU München
02.07.2013

Zurück zur Liste
SMILES: C\C1=C/CC(C)(C)\C=C\C\C(C)=C\CC1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen