Bisphenol-A
4-[2-(4-hydroxyphenyl)-
propan-2-yl]phenol

C15H16O2

Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
27.06.2013

Zurück zur Liste
SMILES: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen