beta-Ionon

C13H20O



Drehung
Stereo
Bindungen
Atome

Stefan Schneider

HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: CC(=O)\C=C\C1=C(C)CCCC1(C)C
Geometrie: Semiempirisch AM1
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen