beta-Carotin

C40H58


Drehung
Stereo
Bindungen
Atome

HUWagner + JBek
LMU München
18.05.2013

Zurück zur Liste
 
SMILES: CC1CCCC(C)(C)\C1=C\C=C(/C)\C=C\C=C(/C)\C=C\C=C\C(\C)=C\C=C\C(\C)=C\C=C1/C(C)CCCC1(C)C
Geometrie: Quantenchemisch DFT B3LYP/3-21G
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen