Benzoxepin166a


C16H16N2O2

Drehung:
Stereo:
Bindungen:
Atome:

Jörg Stetter

HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: CN(C)C1=C(C)C(=O)C2=CC=CC=C2C(O1)\C=C\C#N
Geometrie: Quantenchemisch DFT RB3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen