Benzophenon
Diphenylketon

C13H10O


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
14.06.2013

Zurück zur Liste
 
SMILES: O=C(C1=CC=CC=C1)C1=CC=CC=C1
Geometrie: Quantenmechanisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen