Benzolsulfonsäure

C6H6O3S

Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
03.06.2013

 

Zurück zur Liste
 
SMILES: O[S++]([O-])([O-])C1=CC=CC=C1
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen