Batrachotoxin
Froschgift

C32H44N2O6


Drehung:
Stereo:
Bindungen:
Atome:



HUWagner + JBek
LMU München
21.07.2013

Zurück zur Liste
SMILES: C[C@H](OC(=O)C1=C(C)NC=C1C)C1=CC[C@@]23OCCN(C)C[C@@]12
C[C@@H](O)[C@@]12O[C@@]4(O)CC[C@]1(C)[C@@](C)(CC=C32)C4
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen