Azorubin
OH-Tautomer

Azorubin
NH-Tautomer

C20H12N2O7S2(2-)


Azorubin-
dianion


2 Tautomere

HUWagner + JBek
LMU München
09.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: OC1=C(C=C(C2=C1C=CC=C2)[S++]([O-])([O-])[O-])\N=N\C1=CC=C(C2=C1C=CC=C2)[S++]([O-])([O-])[O-]
[O-][S++]([O-])([O-])C1=CC=C(N\N=C2\C=C(C3=C(C=CC=C3)C2=O)[S++]([O-])([O-])[O-])C2=C1C=CC=C2
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen