trans-Azobenzene

stabiler

cis-Azobenzene

instabiler

C12H10N2




trans/cis
Azobenzene



HUWagner + JBek
LMU München
08.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C1=CC=C(C=C1)\N=N\C1=CC=CC=C1.C1=CC=C(C=C1)\N=N/C1=CC=CC=C1
Geometrie: 2 Konfigurationsisomere Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen