Azaheptafulven113

C9H14N4

Drehung
Stereo
Bindungen
Atome
Günther Glas

HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
SMILES: CN(C)C1=NC2=C(C=CC=C2)C(=C(C#N)C#N)C2=C1C=CC=C2
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen