Azachromophor B 69

C18H16N10


Drehung:
Stereo:
Bindungen:
Atome:

Beate Heinrich

HUWagner + JBek
LMU München
7.9.2013

Zurück zur Liste
SMILES: NC1=N\C(=N/C2=CC=C(C=C2)C2=CC=C(C=C2)\N=C2/N=C(N)N=C2N)C(N)=N1
Geometrie: Quantechemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen