Amidotrizoesäure 10B
3,5-Diacetamido-
2,4,6-triiodobenzoesäure

C11H9I3N2O4

Drehung
Stereo
Bindungen
Atome
Markus Siegert

HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
SMILES: CC(=O)NC1=C(I)C(C(O)=O)=C(I)C(NC(C)=O)=C1I
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen