Amidoschwarz 10B

C22H14N6O9S2

Drehung:
Stereo:
Bindungen:
Atome:

Martin Unglert

HUWagner + JBek
LMU München
20.07.2013

Zurück zur Liste
SMILES: NC1=C(\N=N\C2=CC=C(C=C2)[N+]([O-])=O)C(=CC2=CC(=C(\N=N\C3=CC=CC=C3)C(O)=C12)S([O-])(=O)=O)S([O-])(=O)=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen