S-Alizaprid

C16H21N5O2

Drehung:
Stereo:
Bindungen:
Atome:

Daniel Beck

HUWagner + JBek
LMU München
18.07.2013
Zurück zur Liste

SMILES: OC[C@@]1(O)[C@H]2O[C@@]3(O)O[C@@H]1[C@@H]1[C@@H](O)NC(=[NH2+])N[C@]1([C@@H]2O)[C@@H]3O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen