Alfaxolon

C21H32O3

Drehung:
Stereo:
Bindungen:
Atome:


Verena Kutzner
HUWagner + JBek
LMU München
16.07.2013
Zurück zur Liste
SMILES: [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@H](O)CC[C@]12C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen