Alfacalcidol

C27H44O2



Drehung:
Stereo:
Bindungen:
Atome:

Verena Kutzner

HUWagner + JBek
LMU München
21.07.2013

Zurück zur Liste
SMILES: CC(C)CCC[C@](C)([H])[C@H]1CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen