(3S)-3-Hydroxybutanal

(3R)-3-Hydroxybutanal

C4H8O2

Aldol

2 Enantiomere

HUWagner + JBek
LMU München
21.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@H](O)CC=O.C[C@@H](O)CC=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen