Dipeptid N->COO Ala-Val

Alanin-Valin

C8H17N2O3


Drehung
Stereo
Bindungen
Atome
Amid-Ebene


HUWagner + JBek
LMU München
02.07.2013

 

Zurück zur Liste
 
SMILES: CC(C)[C@H](NC(=O)[C@H](C)N)C(O)=O
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen