Tetrapeptid
ala-ala-ala-ala

C12H22N4O5

Drehung
Stereo
Bindungen
Atome
Amid-Ebenen


HUWagner + JBek
LMU München
6.7.2013

Zurück zur Liste
SMILES: C[C@H]([NH3+])C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C([O-])=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p) cosmo(water)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen