Adenosin

C10H13N5O4

Drehung
Stereo
Bindungen
Atome
Verena Kutzner

HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
SMILES: NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen