Adeninarabinosid

C10H13N5O4

Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
16.07.2013

Zurück zur Liste
SMILES: NC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O)C2=NC=N1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen