Acetylaceton
Ketoform

instabiler

Acetylaceton
Enolform

stabiler

C5H8O2



Pentane-2,4-dione

(3Z)-4-Hydroxy-
pent-3-en-2-on



HUWagner + JBek
LMU München
21.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(=O)CC(C)=O.C\C(O)=C\C(C)=O
Geometrie: Quantenchemisch DFT B3LYP/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen