Abscisinsäure


C15H20O4

Drehung:
Stereo:
Bindungen:
Atome:

M.Grundei

HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
SMILES: CC(\C=C\[C@@]1(O)C(C)=CC(=O)CC1(C)C)=C\C(O)=O
Geometrie: Molekülmechanik Dreiding Kraftfeld
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen