Gelborange
OH-Tautomer

Gelborange
NH-Tautomer

C16H12N2O

Gelborange

2 Tautomere








HUWagner + JBek
LMU München
15.07.2013

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: OC1=C(\N=N\C2=CC=CC=C2)C2=C(C=CC=C2)C=C1.O=C1C=CC2=C(C=CC=C2)\C1=N\NC1=CC=CC=C1
Geometrie:2 Tautomere Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen